weezer010902 weezer010902

03-11-2019
Chemistry

contestada

How many moles of oxygen are required to produce 4 moles of water?

How many moles of oxygen are required to produce 4 moles of water class=

Respuesta :

maizetycorn maizetycorn

03-11-2019

Answer:

6 moles of oxygen

Explanation:We can find from the chemistry equation

C3H7SH(l)+6O2---3CO2(g)+SO2(g)+4H2O(g)

6 moles O2 ~4 moles H2O

Answer Link

soniaaguirre01234 soniaaguirre01234

03-11-2019

6. How do I know? Just took the test boyy

Answer Link

Otras preguntas

5\7m-2-6\7m=-13 what is the answer

Why do you think it is so difficult for some people to accept the idea of continental drift?

Kira is a hemophiliac. This means that she does not produce clotting factors. What aspect of the clotting process should she be worried about not functioning?

Which statement about the Sacco-Vanzetti trial of 1921 is true? A. Many people believed they were convicted solely because they were anarchists. B. The evidence

Work out 3\5 of 7? Working out will help too, thanks:)

Find all the powers of 4 in the range 4 through 1,000.

write 7340 in standard for

Pontius Pilate was the Roman governor of Judea during the time Jesus lived. According to Christian scriptures, what role did Pilate have in Jesus' life? Pilate

write a compound inequality that represents the evelation range for each type of plant life

Which statement best describes the relationship between proteins and nucleic acids? Proteins read the instructions that are contained in nucleic acids. Nucleic