Boone6568 Boone6568
  • 04-08-2020
  • Chemistry
contestada

Name the following compound from the concise formula:______.
CH3CH(CH3)CHCHCH(CH3)CH2CH3
A. 2,4-dimethyl-3-heptene
B. 2,5-dimethyl-3-heptene
C. 3,5-dimethyl-3-heptene
D. 2,5-dimethyl-4-heptene

Respuesta :

michaeld4th
michaeld4th michaeld4th
  • 04-08-2020

Answer:

B. 2,5-dimethyl-3-heptene

Explanation:

Answer Link
mohammedshamil190 mohammedshamil190
  • 04-08-2020

Answer:

B. 2,5-dimethyl-3-heptene

Explanation:

Answer Link

Otras preguntas

How many months is 0.75 of a year
If 6x −3 = −5x +7, then x =? Can someone explain this one?
The square root of 617 is between which two numbers?
what is the term for the condition where red blood shrivels?
what is the definition of bureaucratic personality
The areas of two circles are 36(pi) and 64(pi). What is hte ratio of the diameters? of the circumferences?
Why did immigrants tend to group together in cities?
What is the value of 9P5? A. 45 B. 126 C. 15,120 D . 59,049 A cooking club has 12 members.How many ways can they select a president and vice presiden
Lauren bought 20 ounces of sliced ham. she used 3/4 of the ham to make sandwiches for her friends and 1/5 of the ham in an omelet. how many ounces of ham were l
For f(x)=3x+4, find f(2) and find x such that f(x)=17